| Identification | |
| Name: | 2,6-Anhydro-5-deoxy-D-arabino-hex-5-enitol triacetate |
| Synonyms: | D-arabino-Hex-5-enitol,2,6-anhydro-5-deoxy-, triacetate (9CI);D-lyxo-Hex-1-enopyranose, 1,2-dideoxy-,triacetate (8CI);Galactal, triacetate (6CI);D-Galactal triacetate;Tri-O-acetyl-D-galactal;Triacetyl-D-galactal;Triacetylgalactal; |
| CAS: | 4098-06-0 |
| EINECS: | 223-859-5 |
| Molecular Formula: | C12H16O7 |
| Molecular Weight: | 272.25 |
| InChI: | InChI=1/C12H16O7/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14/h4-5,10-12H,6H2,1-3H3/t10-,11-,12-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.24 g/cm3 |
| Refractive index: | 1.4645-1.4665 |
| Alpha: | -20 º (C=1 CHCL3) |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | pale yellow oil |
| Specification: |
2,6-Anhydro-5-deoxy-D-arabino-hex-5-enitol triacetate , with CAS number of 4098-06-0, can be called (-)-Tri-o-acetyl-d-galactal ; tri-o-acetyl-d-galactal ; d-galactal triacetate ; 3,4,6-tri-o-acetyl-d-galactal ; 3,4,6-tri-o-acetyl-1,5-anhydro-2-deoxy-d-lyxo-hex-1-enitol ; 3,4,6-tri-o-acetyl-1,5-anhydro-d-lyxo-hex-1-enitol ; 1,2-dideoxy-3,4,6-tri-o-acetyl-d-lyxo-1-hexenopyranose ; 1,5-anhydro-2-deoxy-d-lyxo-hex-1-enitol 3,4,6-tri-o-acetyl ether . It is a pale yellow oil. |
| Safety Data | |
 |
|
