| Identification | |
| Name: | Methyl 4-methoxyacetoacetate |
| Synonyms: | 4-Methoxy-3-oxo-butyricacid methyl ester;4-Methoxy-3-oxobutanoic acid methyl ester;4-Methoxyacetoacetic acid methyl ester;Methyl 4-methoxy-3-oxobutanoate;Methyl4-methoxy-3-oxobutyrate;Methyl g-methoxyacetoacetate;g-Methoxyacetoacetic acid methylester; |
| CAS: | 41051-15-4 |
| EINECS: | 255-188-9 |
| Molecular Formula: | C6H10O4 |
| Molecular Weight: | 146.14 |
| InChI: | InChI=1/C6H10O4/c1-9-4-5(7)3-6(8)10-2/h3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.129 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.431-1.433 |
| Appearance: | colorless to yellow liquid |
| Specification: |
Methyl 4-methoxyacetoacetate , with CAS number of 41051-15-4, can be called 4-methoxy-3-oxo-butanoicacimethylester ; Butanoic acid, 4-methoxy-3-oxo-, methyl ester ; Methyl methoxyacetoacetate ; Methyl 4-methoxyacetoxyacetate ; Methyl 4-methoxy-3-oxo-butanoate ; 4-Methoxyacetoacetic acid methyl ester ; methyl 4-methoxy-3-oxobutyrate . It is a colorless to yellow liquid. |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
