| Identification | |
| Name: | Butanamide,N,N'-(2-chloro-5-methyl-1,4-phenylene)bis[3-oxo- |
| Synonyms: | 1,4-Bis(acetoacetamido)-2-chloro-5-methylbenzene; 2-Methyl-5-chloro-1,4-bis(acetoacetylamino)benzene; 5-Chloro-2-methyl-1,4-bis[(acetoacetyl)amino]benzene |
| CAS: | 41131-65-1 |
| EINECS: | 255-235-3 |
| Molecular Formula: | C15H17ClN2O4 |
| Molecular Weight: | 324.75948 |
| InChI: | InChI=1S/C15H17ClN2O4/c1-8-4-13(18-15(22)6-10(3)20)11(16)7-12(8)17-14(21)5-9(2)19/h4,7H,5-6H2,1-3H3,(H,17,21)(H,18,22) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 558.6 ºCat 760 mmHg |
| Boiling Point: | 558.6 ºCat 760 mmHg |
| Density: | 1.33 |
| Refractive index: | 1.596 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | off-white to brownish powder |
| Specification: | Off-white to brownish powder usageEng:Diacetoacet-2-chlor-5-methyl-1,4-phenylenediamide (DiAAclomephdiam) is used as intermediate for the manufacture of organic pigments on the base of bisacetacetic acid Arylides. Product Data Sheet |
| Flash Point: | 558.6 ºCat 760 mmHg |
| Usage: | Diacetoacet-2-chlor-5-methyl-1,4-phenylenediamide (DiAAclomephdiam) is used as intermediate for the manufacture of organic pigments on the base of bisacetacetic acid Arylides. Product Data Sheet |
| Safety Data | |
 |
|
