| Identification | |
| Name: | Ethyl carbazate |
| Synonyms: | Carboethoxy hydrazine; Ethoxycarbonylhydrazine~Ethyl hydrazinocarboxylate; Ethoxy Formhydrazine; Hydrazinoformic acid ethyl ester; Ethyl hydrazine carboxylate: |
| CAS: | 4114-31-2 |
| EINECS: | 223-903-3 |
| Molecular Formula: | C3H8N2O2 |
| Molecular Weight: | 104.11 |
| InChI: | InChI=1/C3H8N2O2/c1-2-7-3(6)5-4/h2,4H2,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 85 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4495 (22 C) |
| Solubility: | Very soluble |
| Appearance: | Light yellow crystal |
| Specification: |
? Hydrazinecarboxylicacid, ethyl ester , its CAS NO. is 4114-31-2, the synonyms are (Ethoxycarbonyl)hydrazide ; (Ethoxycarbonyl)hydrazine ; 1-(Carbethoxy)hydrazine ; 1-(Ethoxycarbonyl)hydrazine ; 1-Carbethoxy hydrazine ; Carbethoxyhydrazine ; Ethyl carbazate ; Ethyl carbazinate ; Ethyl hydrazinecarboxylate ; Ethyl hydrazinocarboxylate ; Ethylcarbazate ; Hydrazinecarboxylic acid, ethyl ester ; Monocarbethoxyhydrazine ; N-(Carbethoxy)hydrazine ; N-(Ethoxycarbonyl)hydrazine . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29280090 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
