Identification |
Name: | Dimethylcarbamic acid - N-methylmethanamine (1:1) |
Synonyms: | also Carbamic acid,dimethyl-,compd. with N-methylmethanamine (1:1);Carbamic acid,dimethyl-,compd. with N-methylmethanamine (1:1);dimethylcarbamic acid; N-methylmethanamine;Dimethylcarbamic acid compd. with dimethylamine (1:1);Dimcarb;Carbamic acid, dimethyl-, compd. with dimethylamine (1:1);with carbon dioxide (9:5) ;; see; |
CAS: | 4137-10-4 |
Molecular Formula: | C5H14N2O2 |
Molecular Weight: | 134.18 |
InChI: | InChI=1/C3H7NO2.C2H7N/c1-4(2)3(5)6;1-3-2/h1-2H3,(H,5,6);3H,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | 2733 |
Melting Point: | °C |
Flash Point: | 150 °F |
Boiling Point: | 60-61 °C(lit.) |
Density: | 1.05 g/mL at 25 °C(lit.) |
Refractive index: | n20/D 1.454(lit.) |
Appearance: | clear colorless to light yellow liquid |
Flash Point: | 150 °F |
Storage Temperature: | 2-8°C |
Safety Data |
|
|