| Identification |
| Name: | Dimethylcarbamic acid - N-methylmethanamine (1:1) |
| Synonyms: | also Carbamic acid,dimethyl-,compd. with N-methylmethanamine (1:1);Carbamic acid,dimethyl-,compd. with N-methylmethanamine (1:1);dimethylcarbamic acid; N-methylmethanamine;Dimethylcarbamic acid compd. with dimethylamine (1:1);Dimcarb;Carbamic acid, dimethyl-, compd. with dimethylamine (1:1);with carbon dioxide (9:5) ;; see; |
| CAS: | 4137-10-4 |
| Molecular Formula: | C5H14N2O2 |
| Molecular Weight: | 134.18 |
| InChI: | InChI=1/C3H7NO2.C2H7N/c1-4(2)3(5)6;1-3-2/h1-2H3,(H,5,6);3H,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2733 |
| Melting Point: | °C |
| Flash Point: | 150 °F |
| Boiling Point: | 60-61 °C(lit.) |
| Density: | 1.05 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.454(lit.) |
| Appearance: | clear colorless to light yellow liquid |
| Flash Point: | 150 °F |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |
