| Identification | |
| Name: | Benzene,1-bromo-4-butyl- |
| Synonyms: | 4-Butylbromobenzene;4-Butylphenyl bromide;4-n-Butylbromobenzene;p-Bromobutylbenzene;p-Butylbromobenzene;p-Butylphenyl bromide;4-Bromobutyl benzene; |
| CAS: | 41492-05-1 |
| EINECS: | 472-210-4 |
| Molecular Formula: | C10H13Br |
| Molecular Weight: | 213.12 |
| InChI: | InChI=1/C10H13Br/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | 243.3°Cat760mmHg |
| Density: | 1.208 |
| Refractive index: | 1.53-1.533 |
| Appearance: | clear colorless to yellow liquid |
| Specification: | clear colorless to yellow liquid usageEng:Intermediates of Liquid Crystals Safety Statements:26-37/39-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection 36:Wear suitable protective clothing |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
