| Identification | |
| Name: | 3-Thiophenecarbonyl chloride |
| Synonyms: | 3-Thenoyl chloride |
| CAS: | 41507-35-1 |
| EINECS: | 255-420-9 |
| Molecular Formula: | C5H3ClOS |
| Molecular Weight: | 146.59 |
| InChI: | InChI=1/C5H3ClOS/c6-5(7)4-1-2-8-3-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Flash Point: | 72°C |
| Boiling Point: | 195.4°C at 760 mmHg |
| Density: | 1.391g/cm3 |
| Refractive index: | 1.576 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
3-Thiophenecarbonylchloride , its cas register number is 41507-35-1. It also can be called 3-Thenoyl chloride . It will cause burns. And when contact with water, it liberates toxic gas. The storage environment of 3-Thiophenecarbonylchloride (CAS NO.41507-35-1) should be dry. |
| Flash Point: | 72°C |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
