| Identification | |
| Name: | 1,1-Cyclobutanedicarboxylatodiammineplatinum (II) |
| Synonyms: | diammine(1,1-cyclobutanedicarboxylato)-platinum(I; Carboplatin; 1,1-Cyclobutanedicarboxylate diamine platinum(II); Paraplatin; CBDCA; cis-(1,1-Cyclobutanedicarboxylato)diamineplatinum(II); cis-Diamine(1,1-cyclobutanedicarboxylato)platinum(II); Platinum, diamine(1,1-cyclobutanedicarboxylato(2-)-O,O')-,(SP-4-2)-; 1,1-Cyclobutanedicarboxylatodiammineplatinum |
| CAS: | 41575-94-4 |
| EINECS: | 255-446-0 |
| Molecular Formula: | C6H12N2O4Pt |
| Molecular Weight: | 373.26436 |
| InChI: | InChI=1S/C6H8O4.2H3N.Pt/c7-4(8)6(5(9)10)2-1-3-6;;;/h1-3H2,(H,7,8)(H,9,10);2*1H3;/q;;;+2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Melting Point: | 228-230oC |
| Flash Point: | 189.6oC |
| Boiling Point: | 366.4oCat 760 mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | white crystalline powder |
| Specification: | White Crystals usageEng:Analog of Cisplatin with reduced nephrotoxicity. Antineoplastic Safety Statements:53-22-26-36/37/39-45 53:Avoid exposure - obtain special instruction before use 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Biological Activity: | Antitumor agent that forms platinum-DNA adducts. Causes intra- and interstrand DNA crosslinks blocking DNA replication and transcription. Enhances radiation-induced single-strand DNA breakage and displays lower nephrotoxicity than analog cisplatin (cis-Diaminodichloroplatinum ). |
| Flash Point: | 189.6oC |
| Storage Temperature: | Store at RT |
| Color: | White crystals |
| Usage: | Analog of Cisplatin with reduced nephrotoxicity. Antineoplastic |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
