| Identification | |
| Name: | Prosta-5,13-dien-1-oicacid, 9,15-dihydroxy-11-oxo-, (5Z,9a,13E,15S)- |
| Synonyms: | 11-DehydroprostaglandinF2a; PGD2; Prostaglandin D2 |
| CAS: | 41598-07-6 |
| EINECS: | 234-237-8 |
| Molecular Formula: | C20H32 O5 |
| Molecular Weight: | 352.52 |
| InChI: | InChI=1/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-18,21-22H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 300.3°C |
| Boiling Point: | 549.6°Cat760mmHg |
| Density: | 1.148g/cm3 |
| Refractive index: | 1.56 |
| Specification: |
Prostaglandin D2 , its cas register number is 41598-07-6. It also can be called 11-Dehydroprostaglandin F2-alpha ; and PGD2 . |
| Flash Point: | 300.3°C |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
