| Identification | |
| Name: | Cyclohexaneacetonitrile,1-cyano- |
| Synonyms: | 1-Cyanocyclohexaneacetonitrile;1-Cyanomethyl-1-cyclohexanenitrile; |
| CAS: | 4172-99-0 |
| Molecular Formula: | C9H12N2 |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C9H12N2/c10-7-6-9(8-11)4-2-1-3-5-9/h1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 154.27°C |
| Boiling Point: | 319.74°C at 760 mmHg |
| Density: | 1.009g/cm3 |
| Refractive index: | 1.478 |
| Appearance: | White to Off-White Solid |
| Specification: | White to Off-White Solid usageEng:An intermediate in the synthesis of Gabapentin |
| Flash Point: | 154.27°C |
| Usage: | An intermediate in the synthesis of Gabapentin |
| Safety Data | |
 |
|
