| Identification | |
| Name: | 3,3'-Dimethylbenzidine dihydrofluoride (o-Tolidine dihydrofluoride) |
| Synonyms: | o-Tolidinedihydrofluoride |
| CAS: | 41766-75-0 |
| Molecular Formula: | C14H16 N2 . 2 F H |
| Molecular Weight: | 212.29024 |
| InChI: | InChI=1S/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1602 |
| Melting Point: | 129-131 deg C |
| Flash Point: | 205.1°C |
| Boiling Point: | 361°C at 760 mmHg |
| Solubility: | Sol in alc, ether, dil acids In water, 1,300 mg/l @ 25 deg C |
| Packinggroup: | III |
| Flash Point: | 205.1°C |
| Color: | White to reddish crystals or powder [Note: Darkens on exposure to air]. |
| Safety Data | |
 |
|
