| Identification | |
| Name: | Benzenemethanamine,3-methoxy-N-methyl- |
| Synonyms: | (3-Methoxybenzyl)methylamine;1-(3-Methoxyphenyl)-N-methylmethanamine;3-Methoxy-1-(methylaminomethyl)benzene;N-(3-Methoxybenzyl)-N-methylamine;N-Methyl-3-methoxybenzylamine; |
| CAS: | 41789-95-1 |
| Molecular Formula: | C9H13NO |
| Molecular Weight: | 151.21 |
| InChI: | InChI=1/C9H13NO/c1-10-7-8-4-3-5-9(6-8)11-2/h3-6,10H,7H2,1-2H3/p+1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.014 |
| Refractive index: | 1.5290 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
