| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedione,6-amino-1,3-dipropyl- |
| Synonyms: | 6-Amino-1,3-dipropyl-1H-pyrimidine-2,4-dione; |
| CAS: | 41862-14-0 |
| Molecular Formula: | C10H17N3O2 |
| Molecular Weight: | 211.26 |
| InChI: | InChI=1/C10H17N3O2/c1-3-5-12-8(11)7-9(14)13(6-4-2)10(12)15/h7H,3-6,11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 140.3°C |
| Boiling Point: | 308.3°C at 760 mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.515 |
| Appearance: | White crystalline solid |
| Specification: |
6-Amino-1,3-dipropyluracil (CAS No.41862-14-0), its synonyms are 6-Amino-1,3-dipropyl-1H-pyrimidine-2,4-dione ; 2,4(1H,3H)-pyrimidinedione, 6-amino-1,3-dipropyl- ; 6-Amino-1,3-dipropylpyrimidine-2,4(1H,3H)-dione . |
| Flash Point: | 140.3°C |
| Usage: | An intermediate used for the sythesis of xanthine derivatives |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
