| Identification | |
| Name: | Isoquinoline,1,2,3,4-tetrahydro-5-nitro- |
| Synonyms: | 1,2,3,4-Tetrahydro-5-nitroisoquinoline;5-Nitro-1,2,3,4-tetrahydroisoquinoline; |
| CAS: | 41959-45-9 |
| Molecular Formula: | C9H10N2O2 |
| Molecular Weight: | 178.19 |
| InChI: | InChI=1/C9H10N2O2/c12-11(13)9-3-1-2-7-6-10-5-4-8(7)9/h1-3,10H,4-6H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.236 g/cm3 |
| Refractive index: | 1.585 |
| Specification: |
The 5-Nitro-1,2,3,4-tetrahydroisoquinoline with the cas number 41959-45-9 is also called Isoquinoline,1,2,3,4-tetrahydro-5-nitro-. Its molecular formula is C9H10N2O2. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.14; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.01; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 1; (7)ACD/KOC (pH 7.4): 7.34; (8)#H bond acceptors: 4; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 49.06 Å2; (12)Index of Refraction: 1.585; (13)Molar Refractivity: 48.32 cm3; (14)Molar Volume: 144.1 cm3; (15)Polarizability: 19.15×10-24cm3; (16)Surface Tension: 49.2 dyne/cm; (17)Enthalpy of Vaporization: 56.21 kJ/mol; (18)Vapour Pressure: 0.000318 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
