| Identification | |
| Name: | 1,10-Phenanthroline,5-nitro- |
| Synonyms: | 5-Nitro-1,10-phenanthroline;5-Nitro-o-phenanthroline;NSC 4263; |
| CAS: | 4199-88-6 |
| EINECS: | 224-097-6 |
| Molecular Formula: | C12H7N3O2 |
| Molecular Weight: | 225.2 |
| InChI: | InChI=1/C12H7N3O2/c16-15(17)10-7-8-3-1-5-13-11(8)12-9(10)4-2-6-14-12/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 222.3 ºC |
| Boiling Point: | 444ºC at 760 mmHg |
| Density: | 1.444 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | Pale yellow or brown solid |
| Specification: |
1,10-Phenanthroline, 5-nitro- (CAS NO.4199-88-6) is also called as 5-Nitro-1, 10-diazaphenanthrene ; 5-Nitro-1,10-phenanthroline ; EINECS 224-097-6 ; NSC 4263 . |
| Flash Point: | 222.3 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | yellow to orange |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
Xi: Irritant
|
 |
|
