| Identification |
| Name: | 4-Chloro-4'-hydroxybenzophenone |
| Synonyms: | Benzophenone,4-chloro-4'-hydroxy- (6CI);(4-Chlorophenyl)(4-hydroxyphenyl)methanone;1-(4-Chlorophenyl)-1-(4-hydroxyphenyl)methanone;4-(4-Chlorobenzoyl)phenol; |
| CAS: | 42019-78-3 |
| EINECS: | 255-627-4 |
| Molecular Formula: | C13H9ClO2 |
| Molecular Weight: | 232.66 |
| InChI: | InChI=1/C13H9ClO2/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8,15H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Density: | 1.307 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.623 |
| Solubility: | Insoluble |
| Appearance: | yellow to brown crystalline powder |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
