| Identification |
| Name: | 1H-Imidazole,2-(4-chlorophenyl)- |
| Synonyms: | Imidazole,2-(p-chlorophenyl)- (7CI,8CI);2-(4-Chlorophenyl)-1H-imidazole;2-(4-Chlorophenyl)imidazole;2-(p-Chlorophenyl)imidazole;NSC 52068; |
| CAS: | 4205-05-4 |
| Molecular Formula: | C9H7ClN2 |
| Molecular Weight: | 178.62 |
| InChI: | InChI=1/C9H7ClN2/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-6H,(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 206.3°C |
| Boiling Point: | 365.5°C at 760 mmHg |
| Density: | 1.292g/cm3 |
| Refractive index: | 1.615 |
| Flash Point: | 206.3°C |
| Safety Data |
| |
 |