| Identification | |
| Name: | Benzoic acid,4-hydroxy-, 2-methylpropyl ester |
| Synonyms: | Benzoicacid, p-hydroxy-, isobutyl ester (6CI,7CI,8CI);2-Methylpropylp-hydroxybenzoate;Isobutyl p-hydroxybenzoate;Isobutylparaben;iso-Butyl p-hydroxybenzoate;p-Hydroxybenzoic acid isobutylester; |
| CAS: | 4247-02-3 |
| EINECS: | 224-208-8 |
| Molecular Formula: | C11H14O3 |
| Molecular Weight: | 194.23 |
| InChI: | InChI=1/C11H14O3/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9/h3-6,8,12H,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 9/PG 3 |
| Melting Point: | 76ºC |
| Density: | 1.105 g/cm3 |
| Refractive index: | 1.524 |
| Appearance: | White cream |
| Specification: | White Solid usageEng:An antimicrobial Safety Statements:22-24/25-61 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Storage Temperature: | 0-6°C |
| Usage: | An antimicrobial |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
