| Identification |
| Name: | 2-HYDROXYPROPIONITRILE |
| CAS: | 42492-95-5 |
| EINECS: | 201-163-2 |
| Molecular Formula: | C3H5NO |
| Molecular Weight: | 71.08 |
| InChI: | InChI=1/C3H5NO/c1-3(5)2-4/h3,5H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3276 6.1/PG 1 |
| Melting Point: | -40 deg C |
| Flash Point: | 64.7°C |
| Boiling Point: | 90 °C17 mm Hg(lit.) |
| Density: | 0.991 g/mL at 20 °C(lit.) |
| Refractive index: | n20/D 1.404 |
| Solubility: | Soluble in water and alcohol; insoluble in petroleum ether and carbon disulfide. Miscible in water and ethanol; soluble in ethyl ether and chloroform. |
| Specification: | Safety Statements:13-36/37/39-45 13:Keep away from food, drink and animal feeding stuffs 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
| Flash Point: | 64.7°C |
| Color: | YELLOW LIQUID Straw-colored liq |
| Safety Data |
| |
 |