| Identification | |
| Name: | 9H-Purin-6-amine,9-(phenylmethyl)- |
| Synonyms: | Adenine,9-benzyl- (7CI,8CI); 9-Benzyladenine; 9-Benzylaminopurine; N9-Benzyladenine;NSC 35649; SQ 21611 |
| CAS: | 4261-14-7 |
| EINECS: | 224-249-1 |
| Molecular Formula: | C12H11 N5 |
| Molecular Weight: | 225.28 |
| InChI: | InChI=1S/C12H11N5/c13-11-10-12(15-7-14-11)17(8-16-10)6-9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H2,13,14,15) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.39 g/cm3 |
| Specification: |
9-Benzyladenine ,its CAS NO. is 4261-14-7,the synonyms is 9-(Phenylmethyl)-9h-purin-6-amin ; 9-(Phenylmethyl)-9h-purin-6-amine ; 9-Bap ; 9-Benzyl-6-aminopurine ; 9-Benzyl-adenin ; 9-Benzylaminopurine ; n(Sup9)-benzyladenine ; 9-Benzyladenin . |
| Usage: | A useful intermediate in the synthesis of 1-substituted adenines |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
