| Identification | |
| Synonyms: | P-Amino benzamide glutamic acid; P-aminobenzamide glutamic acid |
| CAS: | 4271-30-1 |
| EINECS: | 224-261-7 |
| Molecular Formula: | C12H14N2O5 |
| Molecular Weight: | 266.24996 |
| InChI: | InChI=1S/C12H14N2O5/c13-8-3-1-7(2-4-8)11(17)14-9(12(18)19)5-6-10(15)16/h1-4,9H,5-6,13H2,(H,14,17)(H,15,16)(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.418 g/cm3 |
| Refractive index: | 1.617 |
| Alpha: | -15 º (C=2% IN 0.1N HCL) |
| Water Solubility: | Soluble in water (50 mg/ ml-clear to slightly hazy yellow solution) |
| Solubility: | Soluble in water (50 mg/ ml-clear to slightly hazy yellow solution) |
| Appearance: | Beige crystalline powder |
| Specification: | Light Tan Waxy Solid usageEng:Major metabolite of 5-Methyltetrahydrofolic Acid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | −20°C |
| Usage: | Major metabolite of 5-Methyltetrahydrofolic Acid |
| Safety Data | |
 |
|
