| Identification | |
| Name: | 2-Pyridinamine,5-bromo-6-methyl- |
| Synonyms: | 2-Amino-6-methyl-5-bromopyridine;3-Bromo-2-methylpyridin-6-amine;5-Bromo-6-methyl-2-aminopyridine;5-Bromo-6-methylpyridin-2-amine;6-Amino-3-bromo-2-methylpyridine;6-Amino-3-bromo-2-picoline; |
| CAS: | 42753-71-9 |
| EINECS: | 255-927-5 |
| Molecular Formula: | C6H7BrN2 |
| Molecular Weight: | 187.04 |
| InChI: | InChI=1/C6H7BrN2/c1-4-5(7)2-3-6(8)9-4/h2-3H,1H3,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.593 g/cm3 |
| Appearance: | Light yellow crystal |
| Specification: | Light yellow Cryst Safety Statements:26-36-26/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| HS Code: | 29333999 |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
