| Identification | |
| Name: | 1H-Pyrazolo[3,4-d]pyrimidine,4,6-dichloro- |
| Synonyms: | 4,6-Dichloropyrazolo[3,4-d]pyrimidine; |
| CAS: | 42754-96-1 |
| Molecular Formula: | C5H2Cl2N4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H2Cl2N4/c6-3-2-1-8-11-4(2)10-5(7)9-3/h1H,(H,8,9,10,11) |
| Molecular Structure: | ![(C5H2Cl2N4) 4,6-Dichloropyrazolo[3,4-d]pyrimidine;](https://img.guidechem.com/casimg/42754-96-1.gif) |
| Properties | |
| Density: | 1.792g/cm3 |
| Refractive index: | 1.742 |
| Specification: |
The 4,6-Dichloro-1H-pyrazolo[3,4-d]pyrimidine with the cas number 42754-96-1, is also called 4,6-dichloro-1H-pyrazolo[3,4-d]pyrimidine and 1H-Pyrazolo[3,4-d]pyrimidine, 4,6-dichloro-. It belongs to the following product categories: (1)Chiral chemicals; (2)Building Blocks; (3)Pyrazolo[x,x-y]pyridine. And it should be stored at a cool environment. Physical properties about this chemical are: (1)ACD/LogP: 1.69 ; (2)# of Rule of 5 Violations: 0 ; (3)ACD/LogD (pH 5.5): 1.688 ; (4)ACD/LogD (pH 7.4): 1.46 ; (5)ACD/BCF (pH 5.5): 11.276 ; (6)ACD/BCF (pH 7.4): 6.673 ; (7)ACD/KOC (pH 5.5): 196.627 ; (8)ACD/KOC (pH 7.4): 116.357 ; (9)#H bond acceptors: 4 ; (10)#H bond donors: 1 ; (11)#Freely Rotating Bonds: 0 ; (12)Polar Surface Area: 54.46 Å2 ; (13)Index of Refraction: 1.742 ; (14)Molar Refractivity: 42.592 cm3 ; (15)Molar Volume: 105.444 cm3 ; (16)Polarizability: 16.885 ×10-24cm3 ; (17)Surface Tension: 90.128 dyne/cm ; (18)Density: 1.792 g/cm3 You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
