| Identification | |
| Name: | 1H,5H-Benzo[ij]quinolizine-2-carboxylicacid, 9-fluoro-6,7-dihydro-5-methyl-1-oxo- |
| Synonyms: | Apurone;Fantacin;Firestop;Flumigal;Flumiquil;Flumisol;Flumix;Imequyl;R 802;R 802 (bactericide);lumequine; |
| CAS: | 42835-25-6 |
| EINECS: | 255-962-6 |
| Molecular Formula: | C14H12FNO3 |
| Molecular Weight: | 261.248383 |
| InChI: | InChI=1S/C14H12FNO3/c1-7-2-3-8-4-9(15)5-10-12(8)16(7)6-11(13(10)17)14(18)19/h4-7H,2-3H2,1H3,(H,18,19) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 253 - 255 C |
| Density: | 1.45 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.645 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble Appearance:white to off-white powder Transport Information:25kgs Hazard Symbols:UN NO. |
| Appearance: | white to off-white powder |
| Color: | White crystalline powder |
| Usage: | Fluorinated quinolone antibacterial |
| Safety Data | |
 |
|
