| Identification | |
| Name: | Benzonitrile,2-bromo-4-methyl- |
| Synonyms: | p-Tolunitrile,2-bromo- (6CI);2-Bromo-p-tolunitrile; |
| CAS: | 42872-73-1 |
| Molecular Formula: | C8H6BrN |
| Molecular Weight: | 196.04 |
| InChI: | InChI=1/C8H6BrN/c1-6-2-3-7(5-10)8(9)4-6/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Melting Point: | 51-53°C |
| Flash Point: | 130.9°C |
| Density: | 1.51g/cm3 |
| Refractive index: | 1.59 |
| Specification: |
2-Bromo-4-methylbenzonitrile with cas registry number of 42872-73-1 is also known as benzonitrile, 2-bromo-4-methyl- . It would emit toxic vapors when heated to decomposition. This compound is used as a intermediate in the synthesis of phthalocyanine dyes . |
| Flash Point: | 130.9°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
Xn: Harmful
|
 |
|
