| Identification |
| Name: | L-Valine, N-formyl- |
| Synonyms: | NSC 334343;N-Formylvaline;N-Formyl-L-valine;Formylvaline;FVal;Valine, N-formyl-, L- (8CI);Valine,N-formyl- (7CI); |
| CAS: | 4289-97-8 |
| EINECS: | 224-291-0 |
| Molecular Formula: | C6H11NO3 |
| Molecular Weight: | 145.1564 |
| InChI: | InChI=1/C6H11NO3/c1-4(2)5(6(9)10)7-3-8/h3-5H,1-2H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 154 to 156 Celsius Degree |
| Density: | 1.124 g/cm3 |
| Refractive index: | 12 ° (C=4, EtOH) |
| Appearance: | White to off white powder |
| Storage Temperature: | Store at RT. |
| Safety Data |
| |
 |
