| Identification | |
| Name: | Ethanamine,2,2-difluoro- (9CI) |
| Synonyms: | Ethylamine,2,2-difluoro- (7CI,8CI); 2,2-Difluoroethanamine; 2,2-Difluoroethylamine |
| CAS: | 430-67-1 |
| Molecular Formula: | C2H5 F2 N |
| Molecular Weight: | 81.06 |
| InChI: | InChI=1/C2H5F2N/c3-2(4)1-5/h2H,1,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Flash Point: | °C |
| Boiling Point: | 59.4°Cat760mmHg |
| Density: | 1.059g/cm3 |
| Refractive index: | 1.319 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | °C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
Xi: Irritant
|
 |
|
