| Identification | |
| Name: | 2-Propenoic acid,2-fluoro- |
| Synonyms: | Acrylicacid, 2-fluoro- (8CI);2-Fluoroacrylic acid; |
| CAS: | 430-99-9 |
| Molecular Formula: | C3H3FO2 |
| Molecular Weight: | 90.05 |
| InChI: | InChI=1/C3H3FO2/c1-2(4)3(5)6/h1H2,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Melting Point: | 51.5 °C |
| Flash Point: | 63.5°C |
| Boiling Point: | 181.3°Cat760mmHg |
| Density: | 1.233g/cm3 |
| Refractive index: | 1.388 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 63.5°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
