| Identification | |
| Name: | L-Glycero-D-mannoheptose |
| Synonyms: | glycero-manno-heptose |
| CAS: | 4305-74-2 |
| Molecular Formula: | C7H14O7 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h1,3-7,9-14H,2H2/t3-,4-,5-,6-,7+/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 325.9°C |
| Boiling Point: | 592.1°Cat760mmHg |
| Density: | 1.637g/cm3 |
| Refractive index: | 1.596 |
| Specification: | White Solid usageEng:A component of the O-antigenic lipopolysaccharide of Salmonella typhimurium and other gram-negative bacteria |
| Flash Point: | 325.9°C |
| Usage: | A component of the O-antigenic lipopolysaccharide of Salmonella typhimurium and other gram-negative bacteria |
| Safety Data | |
 |
|
