Identification |
Name: | 3-Thiophenecarboxylicacid, 2-amino-4-methyl-, ethyl ester |
Synonyms: | 2-Amino-3-ethoxycarbonyl-4-methylthiophene;2-Amino-4-methylthiophene-3-carboxylic acid ethyl ester;Ethyl2-amino-4-methyl-3-thiophenecarboxylate; |
CAS: | 43088-42-2 |
EINECS: | -0 |
Molecular Formula: | C8H11NO2S |
Molecular Weight: | 185.24 |
InChI: | InChI=1/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 122.6°C |
Boiling Point: | 279.1°C at 760 mmHg |
Density: | 1.219g/cm3 |
Refractive index: | 1.573 |
Specification: | Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Flash Point: | 122.6°C |
Safety Data |
|
|