| Identification |
| Name: | 4-Imidazolidinone,5-(1H-indol-3-ylmethyl)-3-methyl-2-thioxo- |
| Synonyms: | Hydantoin,5-(indol-3-ylmethyl)-3-methyl-2-thio- (7CI,8CI); Nec 1; Necrostatin 1 |
| CAS: | 4311-88-0 |
| Molecular Formula: | C13H13 N3 O S |
| Molecular Weight: | 259.33 |
| InChI: | InChI=1/C13H13N3OS/c1-16-12(17)11(15-13(16)18)6-8-7-14-10-5-3-2-4-9(8)10/h2-5,7,11,14H,6H2,1H3,(H,15,18) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 221.1°C |
| Boiling Point: | 441.9°Cat760mmHg |
| Density: | 1.4g/cm3 |
| Refractive index: | 1.737 |
| Biological Activity: | ATP-competitive death domain receptor-associated adaptor kinase (RIP1) allosteric inhibitor (EC 50 = 182 nM). Blocks non-apoptotic cell death via inhibition of a specific cellular pathway, necroptosis, which leads to necrosis (EC 50 = 494 nM). Reduces ischemic brain injury in a mouse model of stroke. |
| Flash Point: | 221.1°C |
| Storage Temperature: | −20°C |
| Safety Data |
| |
 |
