| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedione,6-chloro-3-methyl- |
| Synonyms: | Uracil,6-chloro-3-methyl- (7CI,8CI);3-Methyl-6-chlorouracil;6-Chloro-3-methylpyrimidine-2,4(1H,3H)-dione;NSC55976;6-Chloro-3-methyl uracil; |
| CAS: | 4318-56-3 |
| Molecular Formula: | C5H5ClN2O2 |
| Molecular Weight: | 160.55 |
| InChI: | InChI=1/C5H5ClN2O2/c1-8-4(9)2-3(6)7-5(8)10/h2H,1H3,(H,7,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Flash Point: | 268.7 °Cat760mmHg |
| Boiling Point: | 268.7 °Cat760mmHg |
| Density: | 1.51 g/cm3 |
| Refractive index: | 1.58 |
| Specification: |
2,4(1H,3H)-Pyrimidinedione,6-chloro-3-methyl- , its cas register number is 4318-56-3. It also can be called 6-Chloro-3-methyluracil ; 6-Chloro-3-methylpyrimidine-2,4(1H,3H)-dione ; and 3-Methyl-6-chlorouracil . |
| Flash Point: | 268.7 °Cat760mmHg |
| Safety Data | |
 |
|
