| Identification |
| Name: | 2,5-Pyridinediamine |
| Synonyms: | Pyridine,2,5-diamino- (6CI,7CI,8CI);NSC 175741; |
| CAS: | 4318-76-7 |
| Molecular Formula: | C5H7N3 |
| Molecular Weight: | 109.13 |
| InChI: | InChI=1/C5H7N3/c6-4-1-2-5(7)8-3-4/h1-3H,6H2,(H2,7,8) |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2671 |
| Melting Point: | 110.3 |
| Flash Point: | 179.1 ºC |
| Density: | 1.251 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.676 |
| Solubility: | 39 g/L (25 C) |
| Appearance: | Yellow to purple crystalline powder |
| Packinggroup: | II |
| Flash Point: | 179.1 ºC |
| Storage Temperature: | Keep container tightly closed. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
