Identification |
Name: | 3-Benzylidene-2,4-pentanedione |
Synonyms: | 3-Acetyl-4-phenyl-3-buten-2-one~(2-Benzylidene)acetylacetone |
CAS: | 4335-90-4 |
EINECS: | 224-382-5 |
Molecular Formula: | C12H12O2 |
Molecular Weight: | 188.22 |
InChI: | InChI=1/C12H12O2/c1-9(13)12(10(2)14)8-11-6-4-3-5-7-11/h3-8H,1-2H3 |
Molecular Structure: |
![(C12H12O2) 3-Acetyl-4-phenyl-3-buten-2-one~(2-Benzylidene)acetylacetone](https://img.guidechem.com/casimg/4335-90-4.gif) |
Properties |
Flash Point: | >230 °F |
Density: | 185 |
Refractive index: | n20/D 1.583(lit.) |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | >230 °F |
Safety Data |
|
![](/images/detail_15.png) |