| Identification | |
| Name: | 3-Benzylidene-2,4-pentanedione |
| Synonyms: | 3-Acetyl-4-phenyl-3-buten-2-one~(2-Benzylidene)acetylacetone |
| CAS: | 4335-90-4 |
| EINECS: | 224-382-5 |
| Molecular Formula: | C12H12O2 |
| Molecular Weight: | 188.22 |
| InChI: | InChI=1/C12H12O2/c1-9(13)12(10(2)14)8-11-6-4-3-5-7-11/h3-8H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >230 °F |
| Density: | 185 |
| Refractive index: | n20/D 1.583(lit.) |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | >230 °F |
| Safety Data | |
 |
|
