Identification |
Name: | 1H-Pyrrole-2,5-dione,1-(4-nitrophenyl)- |
Synonyms: | Maleimide,N-(p-nitrophenyl)- (6CI,7CI,8CI);1-(4-Nitrophenyl)-1H-pyrrole-2,5-dione;N-(4-Nitrophenyl) maleimide;N-(p-Nitrophenyl)maleimide;NSC 39726;NSC 55656;p-Nitrophenylmaleimide; |
CAS: | 4338-06-1 |
Molecular Formula: | C10H6N2O4 |
Molecular Weight: | 218.17 |
InChI: | InChI=1/C10H6N2O4/c13-9-5-6-10(14)11(9)7-1-3-8(4-2-7)12(15)16/h1-6H |
Molecular Structure: |
![(C10H6N2O4) Maleimide,N-(p-nitrophenyl)- (6CI,7CI,8CI);1-(4-Nitrophenyl)-1H-pyrrole-2,5-dione;N-(4-Nitrophenyl) ...](https://img1.guidechem.com/chem/e/dict/38/4338-06-1.jpg) |
Properties |
Melting Point: | 170°C |
Flash Point: | 206.9°C |
Boiling Point: | 418.5°Cat760mmHg |
Density: | 1.535g/cm3 |
Refractive index: | 1.666 |
Specification: | Safety Statements:23-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 206.9°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
![](/images/detail_15.png) |