| Identification | |
| Name: | Estr-4-en-3-one,17-hydroxy-, (17b)- |
| Synonyms: | Estr-4-en-3-one,17b-hydroxy- (8CI);(+)-19-Nortestosterone;(17b)-19-Nortestosterone;17b-Hydroxy-19-nor-4-androsten-3-one;17b-Hydroxyestr-4-en-3-one;17b-Nandrolone;17b-Nortestosterone;19-Nor-17b-hydroxy-3-ketoandrost-4-ene;19-Norandrostenolone;19-Nortestosterone;4-Estren-17b-ol-3-one;4-Estren-3-one-17b-ol;Menidrabol;NSC 3351;Nandrolon;Norandrostenolon;Nortestonate;Nortestosterone;Oestrenolon;d-13b-Methyl-17b-hydroxygon-4-en-3-one;D4-Estren-17b-ol-3-one; |
| CAS: | 434-22-0 |
| EINECS: | 207-101-0 |
| Molecular Formula: | C18H26O2 |
| Molecular Weight: | 274.44 |
| InChI: | InChI=1/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.13g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.564 |
| Solubility: | Insoluble |
| Appearance: | Crystalline solid |
| Specification: | Crystalline Solid usageEng:An anabolic steroid. Controlled substance (anabolic steroid) Safety Statements:22-24/25-36/37/39 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Dimorphic crystals |
| Usage: | An anabolic steroid. Controlled substance (anabolic steroid) |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
