| Identification | |
| Name: | L-Tryptophan,5-hydroxy- |
| Synonyms: | Tryptophan,5-hydroxy-, L- (8CI);(S)-5-Hydroxytryptophan;5-Hydroxy-L-tryptophan;5-Hydroxyl-L-tryptophan;5-Hydroxytryptophan;Cincofarm;L-5-HTP;L-5-Hydroxytryptophan;Levothym;Levotinine;Oxitriptan;Oxyfan;Pretonine;Quietim;Serotonyl;Telesol;Tript-Oh;Triptene;5-HTP; |
| CAS: | 4350-09-8 |
| EINECS: | 224-411-1 |
| Molecular Formula: | C11H12 N2 O3 |
| Molecular Weight: | 220.22458 |
| InChI: | InChI=1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | n20/D 1.4850(lit.) |
| Alpha: | -32.5 o (C=1,H2O ON DRY BASIS) |
| Water Solubility: | Water solubility: 10 mg/mL |
| Solubility: | Water solubility: 10 mg/mL |
| Appearance: | white to off-white powder |
| Specification: | white to pale grey powder usageEng:A labelled metabolite of Tryptophan Safety Statements:36-26 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Packinggroup: | III |
| HS Code: | 29339990 |
| Color: | white |
| Usage: | Marketed as a dietary supplement for use as an antidepressant, appetite suppressant, and sleep aid. |
| Safety Data | |
 |
|
