| Identification | |
| Name: | 4-Quinolinecarboxaldehyde |
| Synonyms: | Cinchoninaldehyde(6CI,7CI,8CI);4-Formylquinoline;4-Quinolinyl aldehyde;Quinoline-4-carbaldehyde; |
| CAS: | 4363-93-3 |
| EINECS: | 224-453-0 |
| Molecular Formula: | C10H7NO |
| Molecular Weight: | 157.17 |
| InChI: | InChI=1/C10H7NO/c12-7-8-5-6-11-10-4-2-1-3-9(8)10/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.223 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.687 |
| Appearance: | Light yellow solid |
| Specification: |
4-Quinolinecarboxaldehyde , with CAS number of 4363-93-3, can be called Quinoline-4-carbaldehyde ; 4-Formylquinoline ; Cinchoninaldehyde(6CI,7CI,8CI) . Polymerization of the 4-Quinolinecarboxaldehyde (CAS NO.4363-93-3) is stable under normal temperature and pressure conditions and you must not take it with incompatible materials , strong oxidizing agents and strong bases.And also prevent it to broken down into hazardous decomposition products: irritating and toxic fumes and gases, oxides of nitrogen, carbon dioxide, carbon monoxide. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
