| Identification | |
| Name: | 4H-1-Benzopyran-4-one,5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy- |
| Synonyms: | Flavone,4',5-dihydroxy-7-methoxy- (7CI,8CI); Genkwanin (6CI);4',5-Dihydroxy-7-methoxyflavone; 5,4'-Dihydroxy-7-methoxyflavone;7-Methylapigenin; 7-O-Methylapigenin; Apigenin 7-O-methyl ether; Apigenin7-methyl ether; Gengkwanin; Genquanin; Henquanin; Puddumetin |
| CAS: | 437-64-9 |
| Molecular Formula: | C16H12 O5 |
| Molecular Weight: | 284.26 |
| InChI: | InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 290-292°C |
| Flash Point: | 209.7°C |
| Boiling Point: | 546.5°Cat760mmHg |
| Density: | 1.42g/cm3 |
| Specification: | Orange Powder usageEng:An antitumor constituent from the leaves of Aquilaria sinensis. Safety Statements:26-36-24/25-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes 22:Do not breathe dust |
| Flash Point: | 209.7°C |
| Storage Temperature: | Hygroscopic, -20?C Freezer, Under Inert Atmosphere |
| Usage: | An antitumor constituent from the leaves of Aquilaria sinensis. |
| Safety Data | |
 |
|
