| Identification | |
| Name: | Benzenemethanol,2,3,4,5,6-pentafluoro- |
| Synonyms: | Benzylalcohol, 2,3,4,5,6-pentafluoro- (6CI,7CI,8CI);(Hydroxymethyl)pentafluorobenzene;(Pentafluorophenyl)methanol;2,3,4,5,6-Pentafluorobenzenemethanol;NSC 97003;Pentafluorobenzyl alcohol; |
| CAS: | 440-60-8 |
| EINECS: | 207-126-7 |
| Molecular Formula: | C7H3F5O |
| Molecular Weight: | 198.09 |
| InChI: | InChI=1/C7H3F5O/c8-3-2(1-13)4(9)6(11)7(12)5(3)10/h13H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.135g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.487 |
| Solubility: | Slightly soluble |
| Appearance: | Colorless - white mass. |
| Specification: | white crystalline mass Safety Statements:36-36/37/39-26-22 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust |
| HS Code: | 29062900 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
