| Identification | |
| Name: | Cyclobuta[1,2-c:3,4-c']difuran-1,3,4,6-tetrone,tetrahydro- |
| Synonyms: | 1,2,3,4-Cyclobutanetetracarboxylic1,2:3,4-dianhydride (7CI,8CI);1,2,3,4-Cyclobutanetetracarboxylic dianhydride(6CI);Cyclobuta[1,2-c:3,4-c']difurantetrone, tetrahydro- (9CI);Cyclobutane-1,2,3,4-tetracarboxylic acid dianhydride;Cyclobutanetetracarboxylic acid dianhydride;Cyclobutanetetracarboxylicdianhydride;Maleic anhydride cyclic dimer; |
| CAS: | 4415-87-6 |
| EINECS: | 224-577-5 |
| Molecular Formula: | C8H4O6 |
| Molecular Weight: | 196.11 |
| InChI: | InChI=1/C8H4O6/c9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1759 |
| Melting Point: | >300 oC |
| Density: | 1.823g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.598 |
| Solubility: | Very soluble |
| Appearance: | White powder. |
| Specification: |
??Cyclobuta[1,2-c:3,4-c']difuran-1,3,4,6-tetrone,tetrahydro- ,?its cas register number is 4415-87-6. It also can be called?Tetrahydrocyclobuta(1,2-c:3,4-c')difuran-1,3,4,6-tetraone ;?Tetrahydrofuro[3',4':3,4]cyclobuta[1,2-c]furan-1,3,4,6-tetron?;?Cyclobutane-1,2,3,4-tetracarboxylic dianhydride?. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
