| Identification | |
| Name: | Benzoic acid,2-fluoro-, ethyl ester |
| Synonyms: | Benzoicacid, o-fluoro-, ethyl ester (6CI,8CI);2-Fluorobenzoic acid ethyl ester;Ethyl2-fluorobenzoate;Ethyl o-fluorobenzoate;NSC 67340; |
| CAS: | 443-26-5 |
| EINECS: | 207-134-0 |
| Molecular Formula: | C9H9FO2 |
| Molecular Weight: | 168.16 |
| InChI: | InChI=1/C9H9FO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.15 |
| Refractive index: | 1.493 |
| Appearance: | colorless transparent liquid |
| Specification: | Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Safety Data | |
| Hazard Symbols |
F:Flammable
|
 |
|
