| Identification |
| Name: | Benzene,1,3-dibromo-5-fluoro-2-methoxy- |
| Synonyms: | 2,6-Dibromo-4-fluorophenyl methyl ether;1,3-Dibromo-5-fluoro-2-methoxybenzene; |
| CAS: | 443-41-4 |
| Molecular Formula: | C7H5Br2FO |
| Molecular Weight: | 283.92 |
| InChI: | InChI=1/C7H5Br2FO/c1-11-7-5(8)2-4(10)3-6(7)9/h2-3H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 132.1°C |
| Boiling Point: | 260.1°Cat760mmHg |
| Density: | 1.892g/cm3 |
| Refractive index: | 1.557 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
| Flash Point: | 132.1°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |