| Identification | |
| Name: | Butanamide,N-(4-chloro-2,5-dimethoxyphenyl)-3-oxo- |
| Synonyms: | 2',5'-Dimethoxy-4'-chloro-acetoacetanilide;C.I. 37613;C.I. Azoic Coupling Component No. 44;Naphthol AS-IRG; |
| CAS: | 4433-79-8 |
| EINECS: | 224-638-6 |
| Molecular Formula: | C12H14ClNO4 |
| Molecular Weight: | 271.7 |
| InChI: | InChI=1/C12H14ClNO4/c1-7(15)4-12(16)14-9-6-10(17-2)8(13)5-11(9)18-3/h5-6H,4H2,1-3H3,(H,14,16) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 215.5°C |
| Boiling Point: | 432.7°C at 760 mmHg |
| Density: | 1.277g/cm3 |
| Refractive index: | 1.553 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION
Appearance:light brown powder Transport Information:25kgs Hazard Symbols:UN NO. Deleted CAS:83936-61-2 |
| Appearance: | light brown powder |
| Flash Point: | 215.5°C |
| Usage: | Acetoacet-4-chloro-2,5-dimethoxyanilide is used as intermediate for the manufacture of organic pigments. |
| Safety Data | |
| Hazard Symbols | |
 |
|
