| Identification | |
| Name: | 1-Butanamine,N,N-diethyl- |
| Synonyms: | Butylamine,N,N-diethyl- (6CI,7CI,8CI); Ethanamine, N-butyl-N-ethyl-;N,N-Diethylbutylamine; N-Butyl-N,N-diethylamine |
| CAS: | 4444-68-2 |
| Molecular Formula: | C8H19 N |
| Molecular Weight: | 129.24 |
| InChI: | InChI=1/C8H19N/c1-4-7-8-9(5-2)6-3/h4-8H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2733 |
| Flash Point: | 26.8°C |
| Boiling Point: | 141°Cat760mmHg |
| Density: | 0.77g/cm3 |
| Refractive index: | n20/D 1.414(lit.) |
| Specification: | Safety Statements:16-26-27-36/37/39-45 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| Flash Point: | 26.8°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
