| Identification |
| Name: | 2,4,5-Trifluorobenzoic acid |
| Synonyms: | 2,4,5-Trifluorobenzoic acid and the derivatives;2,4,5-trifluoro-benzoic acid;2,4,5-trifluorobenzoate; |
| CAS: | 446-17-3 |
| Molecular Formula: | C7H3F3O2 |
| Molecular Weight: | 176.09 |
| InChI: | InChI=1/C7H3F3O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12)/p-1 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.536g/cm3 |
| Refractive index: | 1.49? |
| Appearance: | white to light yellow crystal powder |
| Specification: | white to light yellow crystal powder Safety Statements:26-36-24/25 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 24/25:Avoid contact with skin and eyes |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |