| Identification | |
| Name: | 1-Propanone,1-(2-fluorophenyl)- |
| Synonyms: | Propiophenone,2'-fluoro- (8CI);1-(2-Fluorophenyl)-1-propanone;2-Fluorophenyl ethyl ketone;ZINC00409283;2'-Fluoropropiophenone;AC1LBAO6;Ethyl 2-Fluorophenyl Ketone;AC1Q2RO4; |
| CAS: | 446-22-0 |
| EINECS: | 244-220-7 |
| Molecular Formula: | C9H9FO |
| Molecular Weight: | 152.17 |
| InChI: | InChI=1/C9H9FO/c1-2-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 89 |
| Refractive index: | n20/D 1.5043(lit.) |
| Solubility: | Insoluble in water |
| Appearance: | clear and colorless liquid |
| Specification: | Pale Yellow Oil Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | -20?C Freezer |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
