| Identification | |
| Name: | 2-Fluorobenzyl alcohol |
| Synonyms: | (2-Fluorophenyl)methanol;2-Fluorobenzylic alcohol;o-Fluorobenzyl alcohol;o-Fluoro Benzylalcohol; |
| CAS: | 446-51-5 |
| EINECS: | 207-170-7 |
| Molecular Formula: | C7H7FO |
| Molecular Weight: | 126.13 |
| InChI: | InChI=1/C7H7FO/c8-7-4-2-1-3-6(7)5-9/h1-4,9H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.173 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5126-1.5146 |
| Appearance: | colorless or light yellow liquid |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:23-24/25-45-36/37/39-27-26 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 27:Take off immediately all contaminated clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29062900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
