| Identification | |
| Name: | Senecioic acid amide |
| Synonyms: | 2-butenamide, 3-methyl-;3-Methylbut-2-enamide |
| CAS: | 4479-75-8 |
| Molecular Formula: | C5H9NO |
| Molecular Weight: | 99.1311 |
| InChI: | InChI=1/C5H9NO/c1-4(2)3-5(6)7/h3H,1-2H3,(H2,6,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 91.2°C |
| Boiling Point: | 227.2°C at 760 mmHg |
| Density: | 0.941g/cm3 |
| Refractive index: | 1.457 |
| Specification: |
Senecioic acid amide , its cas register number is 4479-75-8. It also can be called 3-Methylcrotonamide ; 3,3-Dimethylacrylamide ; and Crotonamide, 3-methyl- . |
| Flash Point: | 91.2°C |
| Safety Data | |
 |
|
