| Identification | |
| Name: | Acetamide,N-(4-fluoro-2-nitrophenyl)- |
| Synonyms: | Acetanilide,4'-fluoro-2'-nitro- (6CI,8CI); 4'-Fluoro-2'-nitroacetanilide |
| CAS: | 448-39-5 |
| Molecular Formula: | C8H7 F N2 O3 |
| Molecular Weight: | 198.15 |
| InChI: | InChI=1/C8H7FN2O3/c1-5(12)10-7-3-2-6(9)4-8(7)11(13)14/h2-4H,1H3,(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 71-73 °C(lit.) |
| Flash Point: | 185.4°C |
| Boiling Point: | 383°C at 760 mmHg |
| Density: | 1.429g/cm3 |
| Refractive index: | 1.594 |
| Appearance: | ochre-yellow crystalline powder |
| Specification: | ochre-yellow crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 185.4°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
